C11H25NO3 — CID 95562516
(2S)-3-(diethylamino)-1,1-diethoxypropan-2-ol (PubChem CID 95562516) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is (2S)-3-(diethylamino)-1,1-diethoxypropan-2-ol.
| Compound Name | (2S)-3-(diethylamino)-1,1-diethoxypropan-2-ol |
|---|---|
| PubChem CID | 95562516 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | (2S)-3-(diethylamino)-1,1-diethoxypropan-2-ol |
| SMILES | CCOC(OCC)[C@@H](O)CN(CC)CC |
| InChI | InChI=1S/C11H25NO3/c1-5-12(6-2)9-10(13)11(14-7-3)15-8-4/h10-11,13H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | SFPZYVBTKKNZCM-JTQLQIEISA-N |
| XLogP | 1.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|