C6H16BrNO2 — CID 175089044
2-(diethylamino)ethane-1,1-diol;hydrobromide (PubChem CID 175089044) has the molecular formula C6H16BrNO2 and a molecular weight of 214.10 g/mol. Its IUPAC name is 2-(diethylamino)ethane-1,1-diol;hydrobromide.
| Compound Name | 2-(diethylamino)ethane-1,1-diol;hydrobromide |
|---|---|
| PubChem CID | 175089044 |
| Molecular Formula | C6H16BrNO2 |
| Molecular Weight | 214.10 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-(diethylamino)ethane-1,1-diol;hydrobromide |
| SMILES | Br.CCN(CC)CC(O)O |
| InChI | InChI=1S/C6H15NO2.BrH/c1-3-7(4-2)5-6(8)9;/h6,8-9H,3-5H2,1-2H3;1H |
| InChIKey | PQWIJHJXSNAAJG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.10 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|