C22H48ClNO2 — CID 173150184
2-[ethyl(octadecyl)amino]ethane-1,1-diol;hydrochloride (PubChem CID 173150184) has the molecular formula C22H48ClNO2 and a molecular weight of 394.08 g/mol. Its IUPAC name is 2-[ethyl(octadecyl)amino]ethane-1,1-diol;hydrochloride.
| Compound Name | 2-[ethyl(octadecyl)amino]ethane-1,1-diol;hydrochloride |
|---|---|
| PubChem CID | 173150184 |
| Molecular Formula | C22H48ClNO2 |
| Molecular Weight | 394.08 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | 2-[ethyl(octadecyl)amino]ethane-1,1-diol;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCCN(CC)CC(O)O.Cl |
| InChI | InChI=1S/C22H47NO2.ClH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(4-2)21-22(24)25;/h22,24-25H,3-21H2,1-2H3;1H |
| InChIKey | XNMNGRGBAQBVTD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.08 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|