C21H44ClNO2 — CID 174867707
2-[chloromethyl(octadecyl)amino]ethane-1,1-diol (PubChem CID 174867707) has the molecular formula C21H44ClNO2 and a molecular weight of 378.04 g/mol. Its IUPAC name is 2-[chloromethyl(octadecyl)amino]ethane-1,1-diol.
| Compound Name | 2-[chloromethyl(octadecyl)amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 174867707 |
| Molecular Formula | C21H44ClNO2 |
| Molecular Weight | 378.04 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 2-[chloromethyl(octadecyl)amino]ethane-1,1-diol |
| SMILES | CCCCCCCCCCCCCCCCCCN(CCl)CC(O)O |
| InChI | InChI=1S/C21H44ClNO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(20-22)19-21(24)25/h21,24-25H,2-20H2,1H3 |
| InChIKey | VNYARFLGORYERN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|