About chloromethane;N,N-dioctyloctan-1-amine
chloromethane;N,N-dioctyloctan-1-amine (PubChem CID 87084732) has the molecular formula C25H54ClN
and a molecular weight of 404.17 g/mol. Its IUPAC name is chloromethane;N,N-dioctyloctan-1-amine.
Molecular Properties
| Compound Name | chloromethane;N,N-dioctyloctan-1-amine |
| PubChem CID | 87084732 |
| Molecular Formula | C25H54ClN |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.39 |
| IUPAC Name | chloromethane;N,N-dioctyloctan-1-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.CCl |
| InChI | InChI=1S/C24H51N.CH3Cl/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2/h4-24H2,1-3H3;1H3 |
| InChIKey | VANLTUPWUSFZOU-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;N,N-dioctyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;N,N-dioctyloctan-1-amine?
The IUPAC name of chloromethane;N,N-dioctyloctan-1-amine (CID 87084732) is chloromethane;N,N-dioctyloctan-1-amine.
What is the SMILES notation for chloromethane;N,N-dioctyloctan-1-amine?
The canonical SMILES for chloromethane;N,N-dioctyloctan-1-amine is CCCCCCCCN(CCCCCCCC)CCCCCCCC.CCl.
What is the InChIKey of chloromethane;N,N-dioctyloctan-1-amine?
The InChIKey is VANLTUPWUSFZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.CH3Cl/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2/h4-24H2,1-3H3;1H3.
What are the key properties of chloromethane;N,N-dioctyloctan-1-amine?
chloromethane;N,N-dioctyloctan-1-amine has a molecular weight of 404.17 g/mol, XLogP of 9.22, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;N,N-dioctyloctan-1-amine is sourced from PubChem (CID 87084732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).