C8H18NO3- — CID 139707310
2-[hexyl(oxido)amino]ethane-1,1-diol (PubChem CID 139707310) has the molecular formula C8H18NO3- and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-[hexyl(oxido)amino]ethane-1,1-diol.
| Compound Name | 2-[hexyl(oxido)amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 139707310 |
| Molecular Formula | C8H18NO3- |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-[hexyl(oxido)amino]ethane-1,1-diol |
| SMILES | CCCCCCN([O-])CC(O)O |
| InChI | InChI=1S/C8H18NO3/c1-2-3-4-5-6-9(12)7-8(10)11/h8,10-11H,2-7H2,1H3/q-1 |
| InChIKey | XEXXIDFTOITZND-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|