C9H20NO6P2-3 — CID 136756670
[heptyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium (PubChem CID 136756670) has the molecular formula C9H20NO6P2-3 and a molecular weight of 300.21 g/mol. Its IUPAC name is [heptyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium.
| Compound Name | [heptyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium |
|---|---|
| PubChem CID | 136756670 |
| Molecular Formula | C9H20NO6P2-3 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [heptyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium |
| SMILES | CCCCCCCN(C[P+]([O-])([O-])[O-])C[P+]([O-])([O-])O |
| InChI | InChI=1S/C9H23NO6P2/c1-2-3-4-5-6-7-10(8-17(11,12)13)9-18(14,15)16/h2-9H2,1H3,(H2,11,12,13)(H2,14,15,16)/p-3 |
| InChIKey | GIFYDPWFQBDXKA-UHFFFAOYSA-K |
| XLogP | -2.51 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|