C6H14NO6P2-3 — CID 136707771
[butyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium (PubChem CID 136707771) has the molecular formula C6H14NO6P2-3 and a molecular weight of 258.13 g/mol. Its IUPAC name is [butyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium.
| Compound Name | [butyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium |
|---|---|
| PubChem CID | 136707771 |
| Molecular Formula | C6H14NO6P2-3 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | [butyl-[[hydroxy(dioxido)phosphaniumyl]methyl]amino]methyl-trioxidophosphanium |
| SMILES | CCCCN(C[P+]([O-])([O-])[O-])C[P+]([O-])([O-])O |
| InChI | InChI=1S/C6H17NO6P2/c1-2-3-4-7(5-14(8,9)10)6-15(11,12)13/h2-6H2,1H3,(H2,8,9,10)(H2,11,12,13)/p-3 |
| InChIKey | VXYOTIXPEUMUSS-UHFFFAOYSA-K |
| XLogP | -3.68 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|