About 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride
1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride (PubChem CID 3040181) has the molecular formula C19H46Cl4N2O
and a molecular weight of 460.40 g/mol. Its IUPAC name is 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride.
Molecular Properties
| Compound Name | 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride |
| PubChem CID | 3040181 |
| Molecular Formula | C19H46Cl4N2O |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride |
| SMILES | CCCCN(CCCC)CC(O)CN(CC(C)C)CC(C)C.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C19H42N2O.4ClH/c1-7-9-11-20(12-10-8-2)15-19(22)16-21(13-17(3)4)14-18(5)6;;;;/h17-19,22H,7-16H2,1-6H3;4*1H |
| InChIKey | DXRPUUHVILEHMJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride?
The IUPAC name of 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride (CID 3040181) is 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride.
What is the SMILES notation for 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride?
The canonical SMILES for 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride is CCCCN(CCCC)CC(O)CN(CC(C)C)CC(C)C.Cl.Cl.Cl.Cl.
What is the InChIKey of 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride?
The InChIKey is DXRPUUHVILEHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42N2O.4ClH/c1-7-9-11-20(12-10-8-2)15-19(22)16-21(13-17(3)4)14-18(5)6;;;;/h17-19,22H,7-16H2,1-6H3;4*1H.
What are the key properties of 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride?
1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride has a molecular weight of 460.40 g/mol, XLogP of 5.55, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2-methylpropyl)amino]-3-(dibutylamino)propan-2-ol;tetrahydrochloride is sourced from PubChem (CID 3040181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).