C10H24N2O3 — CID 19100456
6-amino-1-(diethylamino)hexane-2,3,5-triol (PubChem CID 19100456) has the molecular formula C10H24N2O3 and a molecular weight of 220.31 g/mol. Its IUPAC name is 6-amino-1-(diethylamino)hexane-2,3,5-triol.
| Compound Name | 6-amino-1-(diethylamino)hexane-2,3,5-triol |
|---|---|
| PubChem CID | 19100456 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 6-amino-1-(diethylamino)hexane-2,3,5-triol |
| SMILES | CCN(CC)CC(O)C(O)CC(O)CN |
| InChI | InChI=1S/C10H24N2O3/c1-3-12(4-2)7-10(15)9(14)5-8(13)6-11/h8-10,13-15H,3-7,11H2,1-2H3 |
| InChIKey | BTUXRVRIDSABLC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |