About 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol
1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol (PubChem CID 58761117) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol |
| PubChem CID | 58761117 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol |
| SMILES | CCN(CCCCC(C)(C)C)CC(O)CN |
| InChI | InChI=1S/C13H30N2O/c1-5-15(11-12(16)10-14)9-7-6-8-13(2,3)4/h12,16H,5-11,14H2,1-4H3 |
| InChIKey | QBCBSJCMUBCVTH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol?
The IUPAC name of 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol (CID 58761117) is 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol.
What is the SMILES notation for 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol?
The canonical SMILES for 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol is CCN(CCCCC(C)(C)C)CC(O)CN.
What is the InChIKey of 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol?
The InChIKey is QBCBSJCMUBCVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O/c1-5-15(11-12(16)10-14)9-7-6-8-13(2,3)4/h12,16H,5-11,14H2,1-4H3.
What are the key properties of 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol?
1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol has a molecular weight of 230.40 g/mol, XLogP of 1.84, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[5,5-dimethylhexyl(ethyl)amino]propan-2-ol is sourced from PubChem (CID 58761117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).