C11H24O6 — CID 90387499
2,3-diethoxy-4-(2-hydroxyethoxy)pentane-1,5-diol (PubChem CID 90387499) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,3-diethoxy-4-(2-hydroxyethoxy)pentane-1,5-diol.
| Compound Name | 2,3-diethoxy-4-(2-hydroxyethoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 90387499 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,3-diethoxy-4-(2-hydroxyethoxy)pentane-1,5-diol |
| SMILES | CCOC(CO)C(OCC)C(CO)OCCO |
| InChI | InChI=1S/C11H24O6/c1-3-15-9(7-13)11(16-4-2)10(8-14)17-6-5-12/h9-14H,3-8H2,1-2H3 |
| InChIKey | SSBNYIPKSOQZBW-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |