C6H12O6 — CID 21325453
2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid (PubChem CID 21325453) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid.
| Compound Name | 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid |
|---|---|
| PubChem CID | 21325453 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid |
| SMILES | O=C(O)C(O)C(CO)OCCO |
| InChI | InChI=1S/C6H12O6/c7-1-2-12-4(3-8)5(9)6(10)11/h4-5,7-9H,1-3H2,(H,10,11) |
| InChIKey | DBGNZLGFADRTCA-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |