2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid

C6H12O6 — CID 21325453

IUPAC2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid
SMILESO=C(O)C(O)C(CO)OCCO
InChIInChI=1S/C6H12O6/c7-1-2-12-4(3-8)5(9)6(10)11/h4-5,7-9H,1-3H2,(H,10,11)
InChIKeyDBGNZLGFADRTCA-UHFFFAOYSA-N
MW180.16 g/mol
LogP-2.20
Rot. Bonds6

About 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid

2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid (PubChem CID 21325453) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid.

Molecular Properties

Compound Name2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid
PubChem CID21325453
Molecular FormulaC6H12O6
Molecular Weight180.16 g/mol
Exact Mass180.06
IUPAC Name2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid
SMILESO=C(O)C(O)C(CO)OCCO
InChIInChI=1S/C6H12O6/c7-1-2-12-4(3-8)5(9)6(10)11/h4-5,7-9H,1-3H2,(H,10,11)
InChIKeyDBGNZLGFADRTCA-UHFFFAOYSA-N
XLogP-2.20
TPSA107.22 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 5-2.20
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid?
The IUPAC name of 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid (CID 21325453) is 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid.
What is the SMILES notation for 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid?
The canonical SMILES for 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid is O=C(O)C(O)C(CO)OCCO.
What is the InChIKey of 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid?
The InChIKey is DBGNZLGFADRTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6/c7-1-2-12-4(3-8)5(9)6(10)11/h4-5,7-9H,1-3H2,(H,10,11).
What are the key properties of 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid?
2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid has a molecular weight of 180.16 g/mol, XLogP of -2.20, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-3-(2-hydroxyethoxy)butanoic acid is sourced from PubChem (CID 21325453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).