C10H22O7 — CID 22358954
3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butane-1,2,4-triol (PubChem CID 22358954) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butane-1,2,4-triol.
| Compound Name | 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butane-1,2,4-triol |
|---|---|
| PubChem CID | 22358954 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]butane-1,2,4-triol |
| SMILES | OCCOCCOCCOC(CO)C(O)CO |
| InChI | InChI=1S/C10H22O7/c11-1-2-15-3-4-16-5-6-17-10(8-13)9(14)7-12/h9-14H,1-8H2 |
| InChIKey | QGQGZGNEUZLKMN-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|