C9H20O3 — CID 87592876
2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanol (PubChem CID 87592876) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanol.
| Compound Name | 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87592876 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanol |
| SMILES | CC(C)C(C)OCCOCCO |
| InChI | InChI=1S/C9H20O3/c1-8(2)9(3)12-7-6-11-5-4-10/h8-10H,4-7H2,1-3H3 |
| InChIKey | FSEWRVPGAGRVLM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|