C9H21NO2 — CID 103482563
2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanamine (PubChem CID 103482563) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanamine.
| Compound Name | 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanamine |
|---|---|
| PubChem CID | 103482563 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 2-[2-(3-methylbutan-2-yloxy)ethoxy]ethanamine |
| SMILES | CC(C)C(C)OCCOCCN |
| InChI | InChI=1S/C9H21NO2/c1-8(2)9(3)12-7-6-11-5-4-10/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | PPCLITABZCGSIM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|