C13H28O5 — CID 139963056
2-[2-[2-[2-(3-methylbutan-2-yloxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 139963056) has the molecular formula C13H28O5 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[2-[2-[2-(3-methylbutan-2-yloxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-(3-methylbutan-2-yloxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 139963056 |
| Molecular Formula | C13H28O5 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 2-[2-[2-[2-(3-methylbutan-2-yloxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)C(C)OCCOCCOCCOCCO |
| InChI | InChI=1S/C13H28O5/c1-12(2)13(3)18-11-10-17-9-8-16-7-6-15-5-4-14/h12-14H,4-11H2,1-3H3 |
| InChIKey | RZCZELSDSDAWGE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|