C6H13IO3 — CID 87184829
2-[2-(1-iodoethoxy)ethoxy]ethanol (PubChem CID 87184829) has the molecular formula C6H13IO3 and a molecular weight of 260.07 g/mol. Its IUPAC name is 2-[2-(1-iodoethoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(1-iodoethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87184829 |
| Molecular Formula | C6H13IO3 |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 2-[2-(1-iodoethoxy)ethoxy]ethanol |
| SMILES | CC(I)OCCOCCO |
| InChI | InChI=1S/C6H13IO3/c1-6(7)10-5-4-9-3-2-8/h6,8H,2-5H2,1H3 |
| InChIKey | DGUCTYHZOWWGTH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|