C12H26O7 — CID 88771519
2-[2-(2-hydroxyethoxy)ethoxy]-4-(2-hydroxypropoxy)pentane-1,3-diol (PubChem CID 88771519) has the molecular formula C12H26O7 and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-4-(2-hydroxypropoxy)pentane-1,3-diol.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-4-(2-hydroxypropoxy)pentane-1,3-diol |
|---|---|
| PubChem CID | 88771519 |
| Molecular Formula | C12H26O7 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-4-(2-hydroxypropoxy)pentane-1,3-diol |
| SMILES | CC(O)COC(C)C(O)C(CO)OCCOCCO |
| InChI | InChI=1S/C12H26O7/c1-9(15)8-19-10(2)12(16)11(7-14)18-6-5-17-4-3-13/h9-16H,3-8H2,1-2H3 |
| InChIKey | VWWFBOLVACQSDL-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|