C13H28O9 — CID 20813416
1,2,4,5-tetrakis(2-hydroxyethoxy)pentan-3-ol (PubChem CID 20813416) has the molecular formula C13H28O9 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(2-hydroxyethoxy)pentan-3-ol.
| Compound Name | 1,2,4,5-tetrakis(2-hydroxyethoxy)pentan-3-ol |
|---|---|
| PubChem CID | 20813416 |
| Molecular Formula | C13H28O9 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1,2,4,5-tetrakis(2-hydroxyethoxy)pentan-3-ol |
| SMILES | OCCOCC(OCCO)C(O)C(COCCO)OCCO |
| InChI | InChI=1S/C13H28O9/c14-1-5-19-9-11(21-7-3-16)13(18)12(22-8-4-17)10-20-6-2-15/h11-18H,1-10H2 |
| InChIKey | AWAHZBQMGQMGOT-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|