About 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride
1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride (PubChem CID 173050700) has the molecular formula C4H12FNO3
and a molecular weight of 141.14 g/mol. Its IUPAC name is 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride.
Molecular Properties
| Compound Name | 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride |
| PubChem CID | 173050700 |
| Molecular Formula | C4H12FNO3 |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride |
| SMILES | F.NC(O)COCCO |
| InChI | InChI=1S/C4H11NO3.FH/c5-4(7)3-8-2-1-6;/h4,6-7H,1-3,5H2;1H |
| InChIKey | QPQCRUOEMYUTIP-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride?
The IUPAC name of 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride (CID 173050700) is 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride.
What is the SMILES notation for 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride?
The canonical SMILES for 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride is F.NC(O)COCCO.
What is the InChIKey of 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride?
The InChIKey is QPQCRUOEMYUTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO3.FH/c5-4(7)3-8-2-1-6;/h4,6-7H,1-3,5H2;1H.
What are the key properties of 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride?
1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride has a molecular weight of 141.14 g/mol, XLogP of -1.58, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(2-hydroxyethoxy)ethanol;hydrofluoride is sourced from PubChem (CID 173050700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).