About 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene
2-(2-aminopropoxy)ethanol;2-methylbut-2-ene (PubChem CID 174594441) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene.
Molecular Properties
| Compound Name | 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene |
| PubChem CID | 174594441 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene |
| SMILES | CC(N)COCCO.CC=C(C)C |
| InChI | InChI=1S/C5H13NO2.C5H10/c1-5(6)4-8-3-2-7;1-4-5(2)3/h5,7H,2-4,6H2,1H3;4H,1-3H3 |
| InChIKey | BLHHPPKMNGNHBA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene?
The IUPAC name of 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene (CID 174594441) is 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene.
What is the SMILES notation for 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene?
The canonical SMILES for 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene is CC(N)COCCO.CC=C(C)C.
What is the InChIKey of 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene?
The InChIKey is BLHHPPKMNGNHBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C5H10/c1-5(6)4-8-3-2-7;1-4-5(2)3/h5,7H,2-4,6H2,1H3;4H,1-3H3.
What are the key properties of 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene?
2-(2-aminopropoxy)ethanol;2-methylbut-2-ene has a molecular weight of 189.30 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminopropoxy)ethanol;2-methylbut-2-ene is sourced from PubChem (CID 174594441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).