C13H29NO7 — CID 90384666
2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 90384666) has the molecular formula C13H29NO7 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 90384666 |
| Molecular Formula | C13H29NO7 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | COC(N)COCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C13H29NO7/c1-16-13(14)12-21-11-10-20-9-8-19-7-6-18-5-4-17-3-2-15/h13,15H,2-12,14H2,1H3 |
| InChIKey | DDIQMPKAEJBDGS-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|