C16H37NO11S — CID 131724033
2-[2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid (PubChem CID 131724033) has the molecular formula C16H37NO11S and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 131724033 |
| Molecular Formula | C16H37NO11S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-amino-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid |
| SMILES | COC(N)COCCOCCOCCOCCOCCOCCO.CS(=O)(=O)O |
| InChI | InChI=1S/C15H33NO8.CH4O3S/c1-18-15(16)14-24-13-12-23-11-10-22-9-8-21-7-6-20-5-4-19-3-2-17;1-5(2,3)4/h15,17H,2-14,16H2,1H3;1H3,(H,2,3,4) |
| InChIKey | SIKKRODYOTVTDP-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|