C20H46O16S2 — CID 87626226
2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid (PubChem CID 87626226) has the molecular formula C20H46O16S2 and a molecular weight of 606.71 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 87626226 |
| Molecular Formula | C20H46O16S2 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C18H38O10.2CH4O3S/c19-1-3-21-5-7-23-9-11-25-13-15-27-17-18-28-16-14-26-12-10-24-8-6-22-4-2-20;2*1-5(2,3)4/h19-20H,1-18H2;2*1H3,(H,2,3,4) |
| InChIKey | ZKXAUOOBCNJGET-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 223.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|