C14H32O8S — CID 71342368
methanesulfonic acid;2-[2-[2-(2-pentoxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 71342368) has the molecular formula C14H32O8S and a molecular weight of 360.47 g/mol. Its IUPAC name is methanesulfonic acid;2-[2-[2-(2-pentoxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | methanesulfonic acid;2-[2-[2-(2-pentoxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 71342368 |
| Molecular Formula | C14H32O8S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methanesulfonic acid;2-[2-[2-(2-pentoxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | CCCCCOCCOCCOCCOCCO.CS(=O)(=O)O |
| InChI | InChI=1S/C13H28O5.CH4O3S/c1-2-3-4-6-15-8-10-17-12-13-18-11-9-16-7-5-14;1-5(2,3)4/h14H,2-13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | USZFNUHKYGYMBZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|