C16H36O11S — CID 87748726
2-[2-[2-[2-[2-(2-butan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid (PubChem CID 87748726) has the molecular formula C16H36O11S and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-butan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid.
| Compound Name | 2-[2-[2-[2-[2-(2-butan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid |
|---|---|
| PubChem CID | 87748726 |
| Molecular Formula | C16H36O11S |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-butan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid |
| SMILES | CCC(C)OCCOCCOCCOCCOCCOCCO.O=S(=O)(O)O |
| InChI | InChI=1S/C16H34O7.H2O4S/c1-3-16(2)23-15-14-22-13-12-21-11-10-20-9-8-19-7-6-18-5-4-17;1-5(2,3)4/h16-17H,3-15H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | QINCBOSERJVUPH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|