About 2-butan-2-yloxyethanol;rutherfordium
2-butan-2-yloxyethanol;rutherfordium (PubChem CID 164705656) has the molecular formula C6H14O2Rf
and a molecular weight of 385.18 g/mol. Its IUPAC name is 2-butan-2-yloxyethanol;rutherfordium.
Molecular Properties
| Compound Name | 2-butan-2-yloxyethanol;rutherfordium |
| PubChem CID | 164705656 |
| Molecular Formula | C6H14O2Rf |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-butan-2-yloxyethanol;rutherfordium |
| SMILES | CCC(C)OCCO.[Rf] |
| InChI | InChI=1S/C6H14O2.Rf/c1-3-6(2)8-5-4-7;/h6-7H,3-5H2,1-2H3; |
| InChIKey | KPUHKXZBDUXYFT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yloxyethanol;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxyethanol;rutherfordium?
The IUPAC name of 2-butan-2-yloxyethanol;rutherfordium (CID 164705656) is 2-butan-2-yloxyethanol;rutherfordium.
What is the SMILES notation for 2-butan-2-yloxyethanol;rutherfordium?
The canonical SMILES for 2-butan-2-yloxyethanol;rutherfordium is CCC(C)OCCO.[Rf].
What is the InChIKey of 2-butan-2-yloxyethanol;rutherfordium?
The InChIKey is KPUHKXZBDUXYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.Rf/c1-3-6(2)8-5-4-7;/h6-7H,3-5H2,1-2H3;.
What are the key properties of 2-butan-2-yloxyethanol;rutherfordium?
2-butan-2-yloxyethanol;rutherfordium has a molecular weight of 385.18 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxyethanol;rutherfordium is sourced from PubChem (CID 164705656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).