About 2-butan-2-yloxybutane;ethanol
2-butan-2-yloxybutane;ethanol (PubChem CID 88614162) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is 2-butan-2-yloxybutane;ethanol.
Molecular Properties
| Compound Name | 2-butan-2-yloxybutane;ethanol |
| PubChem CID | 88614162 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | 2-butan-2-yloxybutane;ethanol |
| SMILES | CCC(C)OC(C)CC.CCO |
| InChI | InChI=1S/C8H18O.C2H6O/c1-5-7(3)9-8(4)6-2;1-2-3/h7-8H,5-6H2,1-4H3;3H,2H2,1H3 |
| InChIKey | NXSKLNZEPCUNLT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yloxybutane;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxybutane;ethanol?
The IUPAC name of 2-butan-2-yloxybutane;ethanol (CID 88614162) is 2-butan-2-yloxybutane;ethanol.
What is the SMILES notation for 2-butan-2-yloxybutane;ethanol?
The canonical SMILES for 2-butan-2-yloxybutane;ethanol is CCC(C)OC(C)CC.CCO.
What is the InChIKey of 2-butan-2-yloxybutane;ethanol?
The InChIKey is NXSKLNZEPCUNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C2H6O/c1-5-7(3)9-8(4)6-2;1-2-3/h7-8H,5-6H2,1-4H3;3H,2H2,1H3.
What are the key properties of 2-butan-2-yloxybutane;ethanol?
2-butan-2-yloxybutane;ethanol has a molecular weight of 176.30 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxybutane;ethanol is sourced from PubChem (CID 88614162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).