C14H32O7S2 — CID 174496086
2-butan-2-yloxybutane;ethane-1,2-diol;bis(2-sulfanylacetic acid) (PubChem CID 174496086) has the molecular formula C14H32O7S2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-butan-2-yloxybutane;ethane-1,2-diol;bis(2-sulfanylacetic acid).
| Compound Name | 2-butan-2-yloxybutane;ethane-1,2-diol;bis(2-sulfanylacetic acid) |
|---|---|
| PubChem CID | 174496086 |
| Molecular Formula | C14H32O7S2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-butan-2-yloxybutane;ethane-1,2-diol;bis(2-sulfanylacetic acid) |
| SMILES | CCC(C)OC(C)CC.O=C(O)CS.O=C(O)CS.OCCO |
| InChI | InChI=1S/C8H18O.2C2H4O2S.C2H6O2/c1-5-7(3)9-8(4)6-2;2*3-2(4)1-5;3-1-2-4/h7-8H,5-6H2,1-4H3;2*5H,1H2,(H,3,4);3-4H,1-2H2 |
| InChIKey | YDSIOCHGHHYONC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|