About 2-sulfanylacetic acid;1-sulfanylethanol
2-sulfanylacetic acid;1-sulfanylethanol (PubChem CID 87683546) has the molecular formula C4H10O3S2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-sulfanylacetic acid;1-sulfanylethanol.
Molecular Properties
| Compound Name | 2-sulfanylacetic acid;1-sulfanylethanol |
| PubChem CID | 87683546 |
| Molecular Formula | C4H10O3S2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 2-sulfanylacetic acid;1-sulfanylethanol |
| SMILES | CC(O)S.O=C(O)CS |
| InChI | InChI=1S/C2H4O2S.C2H6OS/c3-2(4)1-5;1-2(3)4/h5H,1H2,(H,3,4);2-4H,1H3 |
| InChIKey | JPKZEJXAVCJJIE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylacetic acid;1-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylacetic acid;1-sulfanylethanol?
The IUPAC name of 2-sulfanylacetic acid;1-sulfanylethanol (CID 87683546) is 2-sulfanylacetic acid;1-sulfanylethanol.
What is the SMILES notation for 2-sulfanylacetic acid;1-sulfanylethanol?
The canonical SMILES for 2-sulfanylacetic acid;1-sulfanylethanol is CC(O)S.O=C(O)CS.
What is the InChIKey of 2-sulfanylacetic acid;1-sulfanylethanol?
The InChIKey is JPKZEJXAVCJJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2S.C2H6OS/c3-2(4)1-5;1-2(3)4/h5H,1H2,(H,3,4);2-4H,1H3.
What are the key properties of 2-sulfanylacetic acid;1-sulfanylethanol?
2-sulfanylacetic acid;1-sulfanylethanol has a molecular weight of 170.25 g/mol, XLogP of 0.26, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylacetic acid;1-sulfanylethanol is sourced from PubChem (CID 87683546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).