About 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid
2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid (PubChem CID 87248159) has the molecular formula C4H6O5S2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid |
| PubChem CID | 87248159 |
| Molecular Formula | C4H6O5S2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid |
| SMILES | O=C(O)C(=O)S.O=C(O)CS |
| InChI | InChI=1S/C2H2O3S.C2H4O2S/c3-1(4)2(5)6;3-2(4)1-5/h(H,3,4)(H,5,6);5H,1H2,(H,3,4) |
| InChIKey | CUNVYFMPMVREAV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid?
The IUPAC name of 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid (CID 87248159) is 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid.
What is the SMILES notation for 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid?
The canonical SMILES for 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid is O=C(O)C(=O)S.O=C(O)CS.
What is the InChIKey of 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid?
The InChIKey is CUNVYFMPMVREAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O3S.C2H4O2S/c3-1(4)2(5)6;3-2(4)1-5/h(H,3,4)(H,5,6);5H,1H2,(H,3,4).
What are the key properties of 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid?
2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid has a molecular weight of 198.22 g/mol, XLogP of -0.47, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-sulfanylacetic acid;2-sulfanylacetic acid is sourced from PubChem (CID 87248159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).