About azane;2-butan-2-yloxybutane
azane;2-butan-2-yloxybutane (PubChem CID 87187028) has the molecular formula C8H21NO
and a molecular weight of 147.26 g/mol. Its IUPAC name is azane;2-butan-2-yloxybutane.
Molecular Properties
| Compound Name | azane;2-butan-2-yloxybutane |
| PubChem CID | 87187028 |
| Molecular Formula | C8H21NO |
| Molecular Weight | 147.26 g/mol |
| Exact Mass | 147.16 |
| IUPAC Name | azane;2-butan-2-yloxybutane |
| SMILES | CCC(C)OC(C)CC.N |
| InChI | InChI=1S/C8H18O.H3N/c1-5-7(3)9-8(4)6-2;/h7-8H,5-6H2,1-4H3;1H3 |
| InChIKey | SIERMNXAGSKQAF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-butan-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-butan-2-yloxybutane?
The IUPAC name of azane;2-butan-2-yloxybutane (CID 87187028) is azane;2-butan-2-yloxybutane.
What is the SMILES notation for azane;2-butan-2-yloxybutane?
The canonical SMILES for azane;2-butan-2-yloxybutane is CCC(C)OC(C)CC.N.
What is the InChIKey of azane;2-butan-2-yloxybutane?
The InChIKey is SIERMNXAGSKQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.H3N/c1-5-7(3)9-8(4)6-2;/h7-8H,5-6H2,1-4H3;1H3.
What are the key properties of azane;2-butan-2-yloxybutane?
azane;2-butan-2-yloxybutane has a molecular weight of 147.26 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-butan-2-yloxybutane is sourced from PubChem (CID 87187028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).