C10H24BrNO2 — CID 173067148
2,2-di(butan-2-yloxy)ethanamine;hydrobromide (PubChem CID 173067148) has the molecular formula C10H24BrNO2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 2,2-di(butan-2-yloxy)ethanamine;hydrobromide.
| Compound Name | 2,2-di(butan-2-yloxy)ethanamine;hydrobromide |
|---|---|
| PubChem CID | 173067148 |
| Molecular Formula | C10H24BrNO2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2,2-di(butan-2-yloxy)ethanamine;hydrobromide |
| SMILES | Br.CCC(C)OC(CN)OC(C)CC |
| InChI | InChI=1S/C10H23NO2.BrH/c1-5-8(3)12-10(7-11)13-9(4)6-2;/h8-10H,5-7,11H2,1-4H3;1H |
| InChIKey | BHBYTYWOWUAMFM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|