About 2-methylpropan-1-amine;dihydrobromide
2-methylpropan-1-amine;dihydrobromide (PubChem CID 172812560) has the molecular formula C4H13Br2N
and a molecular weight of 234.96 g/mol. Its IUPAC name is 2-methylpropan-1-amine;dihydrobromide.
Molecular Properties
| Compound Name | 2-methylpropan-1-amine;dihydrobromide |
| PubChem CID | 172812560 |
| Molecular Formula | C4H13Br2N |
| Molecular Weight | 234.96 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 2-methylpropan-1-amine;dihydrobromide |
| SMILES | Br.Br.CC(C)CN |
| InChI | InChI=1S/C4H11N.2BrH/c1-4(2)3-5;;/h4H,3,5H2,1-2H3;2*1H |
| InChIKey | SJOIBXMREOFPMI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.96 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropan-1-amine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-amine;dihydrobromide?
The IUPAC name of 2-methylpropan-1-amine;dihydrobromide (CID 172812560) is 2-methylpropan-1-amine;dihydrobromide.
What is the SMILES notation for 2-methylpropan-1-amine;dihydrobromide?
The canonical SMILES for 2-methylpropan-1-amine;dihydrobromide is Br.Br.CC(C)CN.
What is the InChIKey of 2-methylpropan-1-amine;dihydrobromide?
The InChIKey is SJOIBXMREOFPMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.2BrH/c1-4(2)3-5;;/h4H,3,5H2,1-2H3;2*1H.
What are the key properties of 2-methylpropan-1-amine;dihydrobromide?
2-methylpropan-1-amine;dihydrobromide has a molecular weight of 234.96 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-amine;dihydrobromide is sourced from PubChem (CID 172812560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).