C6H16N2 — CID 87997033
(3S)-2,3-dimethylbutane-1,4-diamine (PubChem CID 87997033) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is (3S)-2,3-dimethylbutane-1,4-diamine.
| Compound Name | (3S)-2,3-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 87997033 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | (3S)-2,3-dimethylbutane-1,4-diamine |
| SMILES | CC(CN)[C@H](C)CN |
| InChI | InChI=1S/C6H16N2/c1-5(3-7)6(2)4-8/h5-6H,3-4,7-8H2,1-2H3/t5-,6?/m1/s1 |
| InChIKey | RMIUJCRSUIITNG-LWOQYNTDSA-N |
| XLogP | 0.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |