C6H14N2O — CID 141007574
(2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate (PubChem CID 141007574) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate.
| Compound Name | (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate |
|---|---|
| PubChem CID | 141007574 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate |
| SMILES | CC(C#N)[C@@H](C)CN.O |
| InChI | InChI=1S/C6H12N2.H2O/c1-5(3-7)6(2)4-8;/h5-6H,3,7H2,1-2H3;1H2/t5-,6?;/m0./s1 |
| InChIKey | OLQQPJHOBBIRQL-GNVLWMSISA-N |
| XLogP | -0.08 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |