About (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate
(2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate (PubChem CID 141007574) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate.
Molecular Properties
| Compound Name | (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate |
| PubChem CID | 141007574 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate |
| SMILES | CC(C#N)[C@@H](C)CN.O |
| InChI | InChI=1S/C6H12N2.H2O/c1-5(3-7)6(2)4-8;/h5-6H,3,7H2,1-2H3;1H2/t5-,6?;/m0./s1 |
| InChIKey | OLQQPJHOBBIRQL-GNVLWMSISA-N |
| XLogP | -0.08 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate?
The IUPAC name of (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate (CID 141007574) is (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate.
What is the SMILES notation for (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate?
The canonical SMILES for (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate is CC(C#N)[C@@H](C)CN.O.
What is the InChIKey of (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate?
The InChIKey is OLQQPJHOBBIRQL-GNVLWMSISA-N. The full InChI is InChI=1S/C6H12N2.H2O/c1-5(3-7)6(2)4-8;/h5-6H,3,7H2,1-2H3;1H2/t5-,6?;/m0./s1.
What are the key properties of (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate?
(2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate has a molecular weight of 130.19 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-4-amino-2,3-dimethylbutanenitrile;hydrate is sourced from PubChem (CID 141007574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).