C5H15N2P — CID 167106466
2-methyl-3-N-phosphanylbutane-1,3-diamine (PubChem CID 167106466) has the molecular formula C5H15N2P and a molecular weight of 134.16 g/mol. Its IUPAC name is 2-methyl-3-N-phosphanylbutane-1,3-diamine.
| Compound Name | 2-methyl-3-N-phosphanylbutane-1,3-diamine |
|---|---|
| PubChem CID | 167106466 |
| Molecular Formula | C5H15N2P |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | 2-methyl-3-N-phosphanylbutane-1,3-diamine |
| SMILES | CC(CN)C(C)NP |
| InChI | InChI=1S/C5H15N2P/c1-4(3-6)5(2)7-8/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | MWFDTFKTQAZUIB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|