C12H17N5 — CID 103205232
3-N-(1,2,4-benzotriazin-3-yl)-2-methylbutane-1,3-diamine (PubChem CID 103205232) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-N-(1,2,4-benzotriazin-3-yl)-2-methylbutane-1,3-diamine.
| Compound Name | 3-N-(1,2,4-benzotriazin-3-yl)-2-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 103205232 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-N-(1,2,4-benzotriazin-3-yl)-2-methylbutane-1,3-diamine |
| SMILES | CC(CN)C(C)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H17N5/c1-8(7-13)9(2)14-12-15-10-5-3-4-6-11(10)16-17-12/h3-6,8-9H,7,13H2,1-2H3,(H,14,15,17) |
| InChIKey | LOANRUHRZBAYOQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |