C15H13ClN4 — CID 103204195
N-[1-(2-chlorophenyl)ethyl]-1,2,4-benzotriazin-3-amine (PubChem CID 103204195) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204195 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-1,2,4-benzotriazin-3-amine |
| SMILES | CC(Nc1nnc2ccccc2n1)c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClN4/c1-10(11-6-2-3-7-12(11)16)17-15-18-13-8-4-5-9-14(13)19-20-15/h2-10H,1H3,(H,17,18,20) |
| InChIKey | OBCKXOBKYBPUKO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |