C15H15N5 — CID 103204777
N-[1-(4-aminophenyl)ethyl]-1,2,4-benzotriazin-3-amine (PubChem CID 103204777) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[1-(4-aminophenyl)ethyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204777 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[1-(4-aminophenyl)ethyl]-1,2,4-benzotriazin-3-amine |
| SMILES | CC(Nc1nnc2ccccc2n1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H15N5/c1-10(11-6-8-12(16)9-7-11)17-15-18-13-4-2-3-5-14(13)19-20-15/h2-10H,16H2,1H3,(H,17,18,20) |
| InChIKey | YJKAXVRFCUDDEN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|