C12H16N4 — CID 103204067
N-(3-methylbutan-2-yl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204067) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(3-methylbutan-2-yl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204067 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-(3-methylbutan-2-yl)-1,2,4-benzotriazin-3-amine |
| SMILES | CC(C)C(C)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H16N4/c1-8(2)9(3)13-12-14-10-6-4-5-7-11(10)15-16-12/h4-9H,1-3H3,(H,13,14,16) |
| InChIKey | BHUKXSCQSZBJQK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |