C12H16N4S — CID 103204497
N-(4-methylsulfanylbutan-2-yl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204497) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(4-methylsulfanylbutan-2-yl)-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(4-methylsulfanylbutan-2-yl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204497 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(4-methylsulfanylbutan-2-yl)-1,2,4-benzotriazin-3-amine |
| SMILES | CSCCC(C)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H16N4S/c1-9(7-8-17-2)13-12-14-10-5-3-4-6-11(10)15-16-12/h3-6,9H,7-8H2,1-2H3,(H,13,14,16) |
| InChIKey | PQEUCCROJIPODQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |