C16H17N5 — CID 103203877
N-[1-[4-(aminomethyl)phenyl]ethyl]-1,2,4-benzotriazin-3-amine (PubChem CID 103203877) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[1-[4-(aminomethyl)phenyl]ethyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[1-[4-(aminomethyl)phenyl]ethyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103203877 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[1-[4-(aminomethyl)phenyl]ethyl]-1,2,4-benzotriazin-3-amine |
| SMILES | CC(Nc1nnc2ccccc2n1)c1ccc(CN)cc1 |
| InChI | InChI=1S/C16H17N5/c1-11(13-8-6-12(10-17)7-9-13)18-16-19-14-4-2-3-5-15(14)20-21-16/h2-9,11H,10,17H2,1H3,(H,18,19,21) |
| InChIKey | FBTXCTBPVNUMPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |