C14H21N5 — CID 106357864
3-N-(1,2,4-benzotriazin-3-yl)-4,4-dimethylpentane-1,3-diamine (PubChem CID 106357864) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 3-N-(1,2,4-benzotriazin-3-yl)-4,4-dimethylpentane-1,3-diamine.
| Compound Name | 3-N-(1,2,4-benzotriazin-3-yl)-4,4-dimethylpentane-1,3-diamine |
|---|---|
| PubChem CID | 106357864 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-N-(1,2,4-benzotriazin-3-yl)-4,4-dimethylpentane-1,3-diamine |
| SMILES | CC(C)(C)C(CCN)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H21N5/c1-14(2,3)12(8-9-15)17-13-16-10-6-4-5-7-11(10)18-19-13/h4-7,12H,8-9,15H2,1-3H3,(H,16,17,19) |
| InChIKey | WHMMBGXKYUDNFU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |