C13H19N5 — CID 103205220
N-(1,2,4-benzotriazin-3-yl)-2-ethylbutane-1,4-diamine (PubChem CID 103205220) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(1,2,4-benzotriazin-3-yl)-2-ethylbutane-1,4-diamine.
| Compound Name | N-(1,2,4-benzotriazin-3-yl)-2-ethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 103205220 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-(1,2,4-benzotriazin-3-yl)-2-ethylbutane-1,4-diamine |
| SMILES | CCC(CCN)CNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H19N5/c1-2-10(7-8-14)9-15-13-16-11-5-3-4-6-12(11)17-18-13/h3-6,10H,2,7-9,14H2,1H3,(H,15,16,18) |
| InChIKey | NSOKEERGBYJEPX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |