C14H19ClN6 — CID 80783650
4-N-[1-(2-chlorophenyl)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80783650) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-N-[1-(2-chlorophenyl)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[1-(2-chlorophenyl)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80783650 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-N-[1-(2-chlorophenyl)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NC(C)c2ccccc2Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H19ClN6/c1-9(10-7-5-6-8-11(10)15)17-13-18-12(16-2)19-14(20-13)21(3)4/h5-9H,1-4H3,(H2,16,17,18,19,20) |
| InChIKey | KHEBEAIWMGCPPH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |