2-(1,2,4-benzotriazin-3-ylamino)butanoic acid

C11H12N4O2 — CID 103203706

IUPAC2-(1,2,4-benzotriazin-3-ylamino)butanoic acid
SMILESCCC(Nc1nnc2ccccc2n1)C(=O)O
InChIInChI=1S/C11H12N4O2/c1-2-7(10(16)17)12-11-13-8-5-3-4-6-9(8)14-15-11/h3-7H,2H2,1H3,(H,16,17)(H,12,13,15)
InChIKeyQWJIDEFCAAIDDY-UHFFFAOYSA-N
MW232.24 g/mol
LogP1.30
Rot. Bonds4

About 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid

2-(1,2,4-benzotriazin-3-ylamino)butanoic acid (PubChem CID 103203706) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid.

Molecular Properties

Compound Name2-(1,2,4-benzotriazin-3-ylamino)butanoic acid
PubChem CID103203706
Molecular FormulaC11H12N4O2
Molecular Weight232.24 g/mol
Exact Mass232.10
IUPAC Name2-(1,2,4-benzotriazin-3-ylamino)butanoic acid
SMILESCCC(Nc1nnc2ccccc2n1)C(=O)O
InChIInChI=1S/C11H12N4O2/c1-2-7(10(16)17)12-11-13-8-5-3-4-6-9(8)14-15-11/h3-7H,2H2,1H3,(H,16,17)(H,12,13,15)
InChIKeyQWJIDEFCAAIDDY-UHFFFAOYSA-N
XLogP1.30
TPSA88.00 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid?
The IUPAC name of 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid (CID 103203706) is 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid.
What is the SMILES notation for 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid?
The canonical SMILES for 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid is CCC(Nc1nnc2ccccc2n1)C(=O)O.
What is the InChIKey of 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid?
The InChIKey is QWJIDEFCAAIDDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-2-7(10(16)17)12-11-13-8-5-3-4-6-9(8)14-15-11/h3-7H,2H2,1H3,(H,16,17)(H,12,13,15).
What are the key properties of 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid?
2-(1,2,4-benzotriazin-3-ylamino)butanoic acid has a molecular weight of 232.24 g/mol, XLogP of 1.30, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid is sourced from PubChem (CID 103203706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).