C11H12N4O2 — CID 103203706
2-(1,2,4-benzotriazin-3-ylamino)butanoic acid (PubChem CID 103203706) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid.
| Compound Name | 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 103203706 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(1,2,4-benzotriazin-3-ylamino)butanoic acid |
| SMILES | CCC(Nc1nnc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C11H12N4O2/c1-2-7(10(16)17)12-11-13-8-5-3-4-6-9(8)14-15-11/h3-7H,2H2,1H3,(H,16,17)(H,12,13,15) |
| InChIKey | QWJIDEFCAAIDDY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |