About ethane;methane;2-methylpropan-1-amine
ethane;methane;2-methylpropan-1-amine (PubChem CID 164904154) has the molecular formula C7H21N
and a molecular weight of 119.25 g/mol. Its IUPAC name is ethane;methane;2-methylpropan-1-amine.
Molecular Properties
| Compound Name | ethane;methane;2-methylpropan-1-amine |
| PubChem CID | 164904154 |
| Molecular Formula | C7H21N |
| Molecular Weight | 119.25 g/mol |
| Exact Mass | 119.17 |
| IUPAC Name | ethane;methane;2-methylpropan-1-amine |
| SMILES | C.CC.CC(C)CN |
| InChI | InChI=1S/C4H11N.C2H6.CH4/c1-4(2)3-5;1-2;/h4H,3,5H2,1-2H3;1-2H3;1H4 |
| InChIKey | ZQYOCLCMULHTNS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methane;2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-methylpropan-1-amine?
The IUPAC name of ethane;methane;2-methylpropan-1-amine (CID 164904154) is ethane;methane;2-methylpropan-1-amine.
What is the SMILES notation for ethane;methane;2-methylpropan-1-amine?
The canonical SMILES for ethane;methane;2-methylpropan-1-amine is C.CC.CC(C)CN.
What is the InChIKey of ethane;methane;2-methylpropan-1-amine?
The InChIKey is ZQYOCLCMULHTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C2H6.CH4/c1-4(2)3-5;1-2;/h4H,3,5H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;2-methylpropan-1-amine?
ethane;methane;2-methylpropan-1-amine has a molecular weight of 119.25 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-methylpropan-1-amine is sourced from PubChem (CID 164904154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).