About butan-2-yloxymercury
butan-2-yloxymercury (PubChem CID 144602861) has the molecular formula C4H9HgO
and a molecular weight of 273.70 g/mol. Its IUPAC name is butan-2-yloxymercury.
Molecular Properties
| Compound Name | butan-2-yloxymercury |
| PubChem CID | 144602861 |
| Molecular Formula | C4H9HgO |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | butan-2-yloxymercury |
| SMILES | CCC(C)O[Hg] |
| InChI | InChI=1S/C4H9O.Hg/c1-3-4(2)5;/h4H,3H2,1-2H3;/q-1;+1 |
| InChIKey | IIZKSJRMOAGLJU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yloxymercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yloxymercury?
The IUPAC name of butan-2-yloxymercury (CID 144602861) is butan-2-yloxymercury.
What is the SMILES notation for butan-2-yloxymercury?
The canonical SMILES for butan-2-yloxymercury is CCC(C)O[Hg].
What is the InChIKey of butan-2-yloxymercury?
The InChIKey is IIZKSJRMOAGLJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.Hg/c1-3-4(2)5;/h4H,3H2,1-2H3;/q-1;+1.
What are the key properties of butan-2-yloxymercury?
butan-2-yloxymercury has a molecular weight of 273.70 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yloxymercury is sourced from PubChem (CID 144602861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).